C17H8Cl2N2O6 — CID 6963439
(4E)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(2-chloro-4-nitrophenyl)-1,3-oxazol-5-one (PubChem CID 6963439) has the molecular formula C17H8Cl2N2O6 and a molecular weight of 407.17 g/mol. Its IUPAC name is (4E)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(2-chloro-4-nitrophenyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(2-chloro-4-nitrophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6963439 |
| Molecular Formula | C17H8Cl2N2O6 |
| Molecular Weight | 407.17 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | (4E)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(2-chloro-4-nitrophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc([N+](=O)[O-])cc2Cl)=N/C1=C/c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C17H8Cl2N2O6/c18-11-6-15-14(25-7-26-15)4-8(11)3-13-17(22)27-16(20-13)10-2-1-9(21(23)24)5-12(10)19/h1-6H,7H2/b13-3+ |
| InChIKey | OGYQOZXLSHZCRQ-QLKAYGNNSA-N |
| XLogP | 3.97 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.17 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|