C17H9BrClNO4 — CID 1110841
2-(4-bromophenyl)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 1110841) has the molecular formula C17H9BrClNO4 and a molecular weight of 406.62 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(4-bromophenyl)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 1110841 |
| Molecular Formula | C17H9BrClNO4 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 404.94 |
| IUPAC Name | 2-(4-bromophenyl)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(Br)cc2)=NC1=Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C17H9BrClNO4/c18-11-3-1-9(2-4-11)16-20-13(17(21)24-16)5-10-6-14-15(7-12(10)19)23-8-22-14/h1-7H,8H2 |
| InChIKey | DPRSVKPLOLCMAV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|