C17H9ClN2O6 — CID 6089293
(4Z)-2-(3-chlorophenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 6089293) has the molecular formula C17H9ClN2O6 and a molecular weight of 372.72 g/mol. Its IUPAC name is (4Z)-2-(3-chlorophenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3-chlorophenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6089293 |
| Molecular Formula | C17H9ClN2O6 |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | (4Z)-2-(3-chlorophenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccc(Cl)c2)=N/C1=C\c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C17H9ClN2O6/c18-11-3-1-2-9(4-11)16-19-12(17(21)26-16)5-10-6-14-15(25-8-24-14)7-13(10)20(22)23/h1-7H,8H2/b12-5- |
| InChIKey | XEWWRUYAZFVIEJ-XGICHPGQSA-N |
| XLogP | 3.32 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|