C18H14N2O6S — CID 30797942
(4E)-2-(5-ethyl-4-methylthiophen-2-yl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 30797942) has the molecular formula C18H14N2O6S and a molecular weight of 386.39 g/mol. Its IUPAC name is (4E)-2-(5-ethyl-4-methylthiophen-2-yl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(5-ethyl-4-methylthiophen-2-yl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 30797942 |
| Molecular Formula | C18H14N2O6S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (4E)-2-(5-ethyl-4-methylthiophen-2-yl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCc1sc(C2=N/C(=C/c3cc4c(cc3[N+](=O)[O-])OCO4)C(=O)O2)cc1C |
| InChI | InChI=1S/C18H14N2O6S/c1-3-15-9(2)4-16(27-15)17-19-11(18(21)26-17)5-10-6-13-14(25-8-24-13)7-12(10)20(22)23/h4-7H,3,8H2,1-2H3/b11-5+ |
| InChIKey | JXLREBPHRODDET-VZUCSPMQSA-N |
| XLogP | 3.60 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|