C19H16N2O7 — CID 9312652
(4Z)-4-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-(4-methoxyphenyl)-1,3-oxazol-5-one (PubChem CID 9312652) has the molecular formula C19H16N2O7 and a molecular weight of 384.34 g/mol. Its IUPAC name is (4Z)-4-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-(4-methoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-(4-methoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9312652 |
| Molecular Formula | C19H16N2O7 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (4Z)-4-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-(4-methoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc(C2=N/C(=C\c3cc(OC)c(OC)cc3[N+](=O)[O-])C(=O)O2)cc1 |
| InChI | InChI=1S/C19H16N2O7/c1-25-13-6-4-11(5-7-13)18-20-14(19(22)28-18)8-12-9-16(26-2)17(27-3)10-15(12)21(23)24/h4-10H,1-3H3/b14-8- |
| InChIKey | GXCSLESTWLTFGO-ZSOIEALJSA-N |
| XLogP | 2.97 |
| TPSA | 109.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|