C19H13F3N2O6 — CID 5233680
4-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-one (PubChem CID 5233680) has the molecular formula C19H13F3N2O6 and a molecular weight of 422.32 g/mol. Its IUPAC name is 4-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-one.
| Compound Name | 4-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 5233680 |
| Molecular Formula | C19H13F3N2O6 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 4-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-one |
| SMILES | COc1cc(C=C2N=C(c3ccc(C(F)(F)F)cc3)OC2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H13F3N2O6/c1-28-15-8-11(14(24(26)27)9-16(15)29-2)7-13-18(25)30-17(23-13)10-3-5-12(6-4-10)19(20,21)22/h3-9H,1-2H3 |
| InChIKey | MTXILTZFKCWCJA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|