C19H15ClN2O7 — CID 3590929
2-(4-chloro-3-nitrophenyl)-4-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 3590929) has the molecular formula C19H15ClN2O7 and a molecular weight of 418.79 g/mol. Its IUPAC name is 2-(4-chloro-3-nitrophenyl)-4-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(4-chloro-3-nitrophenyl)-4-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3590929 |
| Molecular Formula | C19H15ClN2O7 |
| Molecular Weight | 418.79 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 2-(4-chloro-3-nitrophenyl)-4-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1ccc(C=C2N=C(c3ccc(Cl)c([N+](=O)[O-])c3)OC2=O)c(OC)c1OC |
| InChI | InChI=1S/C19H15ClN2O7/c1-26-15-7-5-10(16(27-2)17(15)28-3)8-13-19(23)29-18(21-13)11-4-6-12(20)14(9-11)22(24)25/h4-9H,1-3H3 |
| InChIKey | FYWCGCGJGDUSMZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 109.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.79 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|