C21H14ClN3O5 — CID 2434009
(4E)-4-[(2-chloro-6-methylquinolin-3-yl)methylidene]-2-(4-methoxy-3-nitrophenyl)-1,3-oxazol-5-one (PubChem CID 2434009) has the molecular formula C21H14ClN3O5 and a molecular weight of 423.81 g/mol. Its IUPAC name is (4E)-4-[(2-chloro-6-methylquinolin-3-yl)methylidene]-2-(4-methoxy-3-nitrophenyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(2-chloro-6-methylquinolin-3-yl)methylidene]-2-(4-methoxy-3-nitrophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2434009 |
| Molecular Formula | C21H14ClN3O5 |
| Molecular Weight | 423.81 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | (4E)-4-[(2-chloro-6-methylquinolin-3-yl)methylidene]-2-(4-methoxy-3-nitrophenyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc(C2=N/C(=C/c3cc4cc(C)ccc4nc3Cl)C(=O)O2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H14ClN3O5/c1-11-3-5-15-13(7-11)8-14(19(22)23-15)9-16-21(26)30-20(24-16)12-4-6-18(29-2)17(10-12)25(27)28/h3-10H,1-2H3/b16-9+ |
| InChIKey | NGOQSBNSOWDFSB-CXUHLZMHSA-N |
| XLogP | 4.46 |
| TPSA | 103.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|