C18H14N2O6 — CID 6514059
(4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-(2-nitrophenyl)-1,3-oxazol-5-one (PubChem CID 6514059) has the molecular formula C18H14N2O6 and a molecular weight of 354.32 g/mol. Its IUPAC name is (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-(2-nitrophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-(2-nitrophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6514059 |
| Molecular Formula | C18H14N2O6 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (4Z)-4-[(2,5-dimethoxyphenyl)methylidene]-2-(2-nitrophenyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc(OC)c(/C=C2\N=C(c3ccccc3[N+](=O)[O-])OC2=O)c1 |
| InChI | InChI=1S/C18H14N2O6/c1-24-12-7-8-16(25-2)11(9-12)10-14-18(21)26-17(19-14)13-5-3-4-6-15(13)20(22)23/h3-10H,1-2H3/b14-10- |
| InChIKey | WQTZLWFCDMGCOB-UVTDQMKNSA-N |
| XLogP | 2.96 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|