C18H13N3O7 — CID 19666696
(4Z)-4-[(2-methoxy-5-nitrophenyl)methylidene]-2-(2-methyl-3-nitrophenyl)-1,3-oxazol-5-one (PubChem CID 19666696) has the molecular formula C18H13N3O7 and a molecular weight of 383.32 g/mol. Its IUPAC name is (4Z)-4-[(2-methoxy-5-nitrophenyl)methylidene]-2-(2-methyl-3-nitrophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2-methoxy-5-nitrophenyl)methylidene]-2-(2-methyl-3-nitrophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19666696 |
| Molecular Formula | C18H13N3O7 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (4Z)-4-[(2-methoxy-5-nitrophenyl)methylidene]-2-(2-methyl-3-nitrophenyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc([N+](=O)[O-])cc1/C=C1\N=C(c2cccc([N+](=O)[O-])c2C)OC1=O |
| InChI | InChI=1S/C18H13N3O7/c1-10-13(4-3-5-15(10)21(25)26)17-19-14(18(22)28-17)9-11-8-12(20(23)24)6-7-16(11)27-2/h3-9H,1-2H3/b14-9- |
| InChIKey | WDMLKGPQSWMIKC-ZROIWOOFSA-N |
| XLogP | 3.16 |
| TPSA | 134.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|