C14H8ClNO3 — CID 4015781
4-[(3-chlorophenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one (PubChem CID 4015781) has the molecular formula C14H8ClNO3 and a molecular weight of 273.68 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one.
| Compound Name | 4-[(3-chlorophenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4015781 |
| Molecular Formula | C14H8ClNO3 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 4-[(3-chlorophenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccco2)=NC1=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H8ClNO3/c15-10-4-1-3-9(7-10)8-11-14(17)19-13(16-11)12-5-2-6-18-12/h1-8H |
| InChIKey | FWYHOFDGRGRTTF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|