C17H11Br2NO4 — CID 19663204
(4Z)-4-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one (PubChem CID 19663204) has the molecular formula C17H11Br2NO4 and a molecular weight of 453.09 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19663204 |
| Molecular Formula | C17H11Br2NO4 |
| Molecular Weight | 453.09 g/mol |
| Exact Mass | 450.91 |
| IUPAC Name | (4Z)-4-[(3,5-dibromo-4-prop-2-enoxyphenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
| SMILES | C=CCOc1c(Br)cc(/C=C2\N=C(c3ccco3)OC2=O)cc1Br |
| InChI | InChI=1S/C17H11Br2NO4/c1-2-5-23-15-11(18)7-10(8-12(15)19)9-13-17(21)24-16(20-13)14-4-3-6-22-14/h2-4,6-9H,1,5H2/b13-9- |
| InChIKey | ABANKEVRQXMZJA-LCYFTJDESA-N |
| XLogP | 4.71 |
| TPSA | 61.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.09 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|