C21H13Br2NO4 — CID 19663193
(4Z)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one (PubChem CID 19663193) has the molecular formula C21H13Br2NO4 and a molecular weight of 503.15 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19663193 |
| Molecular Formula | C21H13Br2NO4 |
| Molecular Weight | 503.15 g/mol |
| Exact Mass | 500.92 |
| IUPAC Name | (4Z)-4-[(3,5-dibromo-4-phenylmethoxyphenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccco2)=N/C1=C\c1cc(Br)c(OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C21H13Br2NO4/c22-15-9-14(10-16(23)19(15)27-12-13-5-2-1-3-6-13)11-17-21(25)28-20(24-17)18-7-4-8-26-18/h1-11H,12H2/b17-11- |
| InChIKey | QUTIMEHAURGRGI-BOPFTXTBSA-N |
| XLogP | 5.73 |
| TPSA | 61.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.15 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|