C22H16BrNO5 — CID 19663351
(4Z)-4-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one (PubChem CID 19663351) has the molecular formula C22H16BrNO5 and a molecular weight of 454.28 g/mol. Its IUPAC name is (4Z)-4-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19663351 |
| Molecular Formula | C22H16BrNO5 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | (4Z)-4-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccco3)OC2=O)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H16BrNO5/c1-26-20-12-15(6-9-18(20)28-13-14-4-7-16(23)8-5-14)11-17-22(25)29-21(24-17)19-3-2-10-27-19/h2-12H,13H2,1H3/b17-11- |
| InChIKey | AJFXLXOXANYIQT-BOPFTXTBSA-N |
| XLogP | 4.97 |
| TPSA | 70.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|