C21H12Br2FNO4 — CID 19663297
(4Z)-4-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one (PubChem CID 19663297) has the molecular formula C21H12Br2FNO4 and a molecular weight of 521.14 g/mol. Its IUPAC name is (4Z)-4-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19663297 |
| Molecular Formula | C21H12Br2FNO4 |
| Molecular Weight | 521.14 g/mol |
| Exact Mass | 518.91 |
| IUPAC Name | (4Z)-4-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccco2)=N/C1=C\c1cc(Br)c(OCc2cccc(F)c2)c(Br)c1 |
| InChI | InChI=1S/C21H12Br2FNO4/c22-15-8-13(10-17-21(26)29-20(25-17)18-5-2-6-27-18)9-16(23)19(15)28-11-12-3-1-4-14(24)7-12/h1-10H,11H2/b17-10- |
| InChIKey | KIOPCEJAUSITLN-YVLHZVERSA-N |
| XLogP | 5.87 |
| TPSA | 61.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.14 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|