C23H13Br2F2NO3 — CID 19665867
(4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one (PubChem CID 19665867) has the molecular formula C23H13Br2F2NO3 and a molecular weight of 549.17 g/mol. Its IUPAC name is (4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19665867 |
| Molecular Formula | C23H13Br2F2NO3 |
| Molecular Weight | 549.17 g/mol |
| Exact Mass | 546.92 |
| IUPAC Name | (4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccc(F)c2)=N/C1=C\c1cc(Br)c(OCc2ccc(F)cc2)c(Br)c1 |
| InChI | InChI=1S/C23H13Br2F2NO3/c24-18-8-14(9-19(25)21(18)30-12-13-4-6-16(26)7-5-13)10-20-23(29)31-22(28-20)15-2-1-3-17(27)11-15/h1-11H,12H2/b20-10- |
| InChIKey | GVUJZGWRAICJIY-JMIUGGIZSA-N |
| XLogP | 6.41 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.17 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|