C27H16Br2FNO3 — CID 19674644
(4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one (PubChem CID 19674644) has the molecular formula C27H16Br2FNO3 and a molecular weight of 581.24 g/mol. Its IUPAC name is (4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19674644 |
| Molecular Formula | C27H16Br2FNO3 |
| Molecular Weight | 581.24 g/mol |
| Exact Mass | 578.95 |
| IUPAC Name | (4Z)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc3ccccc3c2)=N/C1=C\c1cc(Br)c(OCc2ccc(F)cc2)c(Br)c1 |
| InChI | InChI=1S/C27H16Br2FNO3/c28-22-11-17(12-23(29)25(22)33-15-16-5-9-21(30)10-6-16)13-24-27(32)34-26(31-24)20-8-7-18-3-1-2-4-19(18)14-20/h1-14H,15H2/b24-13- |
| InChIKey | OIUQLUJXABIDQZ-CFRMEGHHSA-N |
| XLogP | 7.43 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.24 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|