C24H19Br2NO3 — CID 19674913
(4Z)-4-[[3,5-dibromo-4-(2-methylpropoxy)phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one (PubChem CID 19674913) has the molecular formula C24H19Br2NO3 and a molecular weight of 529.23 g/mol. Its IUPAC name is (4Z)-4-[[3,5-dibromo-4-(2-methylpropoxy)phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3,5-dibromo-4-(2-methylpropoxy)phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19674913 |
| Molecular Formula | C24H19Br2NO3 |
| Molecular Weight | 529.23 g/mol |
| Exact Mass | 526.97 |
| IUPAC Name | (4Z)-4-[[3,5-dibromo-4-(2-methylpropoxy)phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one |
| SMILES | CC(C)COc1c(Br)cc(/C=C2\N=C(c3ccc4ccccc4c3)OC2=O)cc1Br |
| InChI | InChI=1S/C24H19Br2NO3/c1-14(2)13-29-22-19(25)9-15(10-20(22)26)11-21-24(28)30-23(27-21)18-8-7-16-5-3-4-6-17(16)12-18/h3-12,14H,13H2,1-2H3/b21-11- |
| InChIKey | UURLSLNFAOULEH-NHDPSOOVSA-N |
| XLogP | 6.74 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.23 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|