C22H16BrNO4 — CID 1353728
(4Z)-4-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one (PubChem CID 1353728) has the molecular formula C22H16BrNO4 and a molecular weight of 438.28 g/mol. Its IUPAC name is (4Z)-4-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 1353728 |
| Molecular Formula | C22H16BrNO4 |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | (4Z)-4-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccc4ccccc4c3)OC2=O)cc(Br)c1OC |
| InChI | InChI=1S/C22H16BrNO4/c1-26-19-11-13(9-17(23)20(19)27-2)10-18-22(25)28-21(24-18)16-8-7-14-5-3-4-6-15(14)12-16/h3-12H,1-2H3/b18-10- |
| InChIKey | CKAMTSIXELBARU-ZDLGFXPLSA-N |
| XLogP | 4.96 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|