C26H22BrNO6 — CID 19674884
ethyl 2-[2-bromo-6-ethoxy-4-[(Z)-(2-naphthalen-2-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenoxy]acetate (PubChem CID 19674884) has the molecular formula C26H22BrNO6 and a molecular weight of 524.37 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-ethoxy-4-[(Z)-(2-naphthalen-2-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-ethoxy-4-[(Z)-(2-naphthalen-2-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19674884 |
| Molecular Formula | C26H22BrNO6 |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | ethyl 2-[2-bromo-6-ethoxy-4-[(Z)-(2-naphthalen-2-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=C2\N=C(c3ccc4ccccc4c3)OC2=O)cc1OCC |
| InChI | InChI=1S/C26H22BrNO6/c1-3-31-22-13-16(11-20(27)24(22)33-15-23(29)32-4-2)12-21-26(30)34-25(28-21)19-10-9-17-7-5-6-8-18(17)14-19/h5-14H,3-4,15H2,1-2H3/b21-12- |
| InChIKey | DIFLOVNDNFTFGG-MTJSOVHGSA-N |
| XLogP | 5.29 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|