C23H21BrN2O8 — CID 19667667
ethyl 2-[2-bromo-6-ethoxy-4-[(Z)-[2-(3-methyl-4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 19667667) has the molecular formula C23H21BrN2O8 and a molecular weight of 533.33 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-ethoxy-4-[(Z)-[2-(3-methyl-4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-ethoxy-4-[(Z)-[2-(3-methyl-4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19667667 |
| Molecular Formula | C23H21BrN2O8 |
| Molecular Weight | 533.33 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | ethyl 2-[2-bromo-6-ethoxy-4-[(Z)-[2-(3-methyl-4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=C2\N=C(c3ccc([N+](=O)[O-])c(C)c3)OC2=O)cc1OCC |
| InChI | InChI=1S/C23H21BrN2O8/c1-4-31-19-11-14(9-16(24)21(19)33-12-20(27)32-5-2)10-17-23(28)34-22(25-17)15-6-7-18(26(29)30)13(3)8-15/h6-11H,4-5,12H2,1-3H3/b17-10- |
| InChIKey | FFGGWHWVUJYTHV-YVLHZVERSA-N |
| XLogP | 4.35 |
| TPSA | 126.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|