C23H13Br3FNO3 — CID 19669758
(4Z)-2-(3-bromophenyl)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 19669758) has the molecular formula C23H13Br3FNO3 and a molecular weight of 610.07 g/mol. Its IUPAC name is (4Z)-2-(3-bromophenyl)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3-bromophenyl)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19669758 |
| Molecular Formula | C23H13Br3FNO3 |
| Molecular Weight | 610.07 g/mol |
| Exact Mass | 606.84 |
| IUPAC Name | (4Z)-2-(3-bromophenyl)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccc(Br)c2)=N/C1=C\c1cc(Br)c(OCc2ccc(F)cc2)c(Br)c1 |
| InChI | InChI=1S/C23H13Br3FNO3/c24-16-3-1-2-15(11-16)22-28-20(23(29)31-22)10-14-8-18(25)21(19(26)9-14)30-12-13-4-6-17(27)7-5-13/h1-11H,12H2/b20-10- |
| InChIKey | OMIGIMCFGWYSFZ-JMIUGGIZSA-N |
| XLogP | 7.04 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.07 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|