C18H13Br2NO5 — CID 19663237
[2,6-dibromo-4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate (PubChem CID 19663237) has the molecular formula C18H13Br2NO5 and a molecular weight of 483.11 g/mol. Its IUPAC name is [2,6-dibromo-4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate.
| Compound Name | [2,6-dibromo-4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate |
|---|---|
| PubChem CID | 19663237 |
| Molecular Formula | C18H13Br2NO5 |
| Molecular Weight | 483.11 g/mol |
| Exact Mass | 480.92 |
| IUPAC Name | [2,6-dibromo-4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1c(Br)cc(/C=C2\N=C(c3ccco3)OC2=O)cc1Br |
| InChI | InChI=1S/C18H13Br2NO5/c1-2-4-15(22)25-16-11(19)7-10(8-12(16)20)9-13-18(23)26-17(21-13)14-5-3-6-24-14/h3,5-9H,2,4H2,1H3/b13-9- |
| InChIKey | SCPOMWDEAIJGMY-LCYFTJDESA-N |
| XLogP | 4.85 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.11 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|