C16H9I2NO5 — CID 6162634
[4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] acetate (PubChem CID 6162634) has the molecular formula C16H9I2NO5 and a molecular weight of 549.06 g/mol. Its IUPAC name is [4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] acetate.
| Compound Name | [4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] acetate |
|---|---|
| PubChem CID | 6162634 |
| Molecular Formula | C16H9I2NO5 |
| Molecular Weight | 549.06 g/mol |
| Exact Mass | 548.86 |
| IUPAC Name | [4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] acetate |
| SMILES | CC(=O)Oc1c(I)cc(/C=C2\N=C(c3ccco3)OC2=O)cc1I |
| InChI | InChI=1S/C16H9I2NO5/c1-8(20)23-14-10(17)5-9(6-11(14)18)7-12-16(21)24-15(19-12)13-3-2-4-22-13/h2-7H,1H3/b12-7- |
| InChIKey | OLKYPHNANZRBQW-GHXNOFRVSA-N |
| XLogP | 3.76 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.06 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|