C19H16INO7 — CID 1017130
ethyl 2-[4-[(E)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 1017130) has the molecular formula C19H16INO7 and a molecular weight of 497.24 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 1017130 |
| Molecular Formula | C19H16INO7 |
| Molecular Weight | 497.24 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | ethyl 2-[4-[(E)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2/N=C(c3ccco3)OC2=O)cc1OC |
| InChI | InChI=1S/C19H16INO7/c1-3-25-16(22)10-27-17-12(20)7-11(9-15(17)24-2)8-13-19(23)28-18(21-13)14-5-4-6-26-14/h4-9H,3,10H2,1-2H3/b13-8+ |
| InChIKey | VCDHTTNDKNPAIU-MDWZMJQESA-N |
| XLogP | 3.18 |
| TPSA | 96.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|