C21H17ClINO6 — CID 19664324
ethyl 2-[4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 19664324) has the molecular formula C21H17ClINO6 and a molecular weight of 541.73 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 19664324 |
| Molecular Formula | C21H17ClINO6 |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 540.98 |
| IUPAC Name | ethyl 2-[4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2\N=C(c3ccccc3Cl)OC2=O)cc1OC |
| InChI | InChI=1S/C21H17ClINO6/c1-3-28-18(25)11-29-19-15(23)8-12(10-17(19)27-2)9-16-21(26)30-20(24-16)13-6-4-5-7-14(13)22/h4-10H,3,11H2,1-2H3/b16-9- |
| InChIKey | NDWOTMKLYOXIMR-SXGWCWSVSA-N |
| XLogP | 4.24 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|