C17H12INO6 — CID 3589004
[4-[[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate (PubChem CID 3589004) has the molecular formula C17H12INO6 and a molecular weight of 453.19 g/mol. Its IUPAC name is [4-[[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate.
| Compound Name | [4-[[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 3589004 |
| Molecular Formula | C17H12INO6 |
| Molecular Weight | 453.19 g/mol |
| Exact Mass | 452.97 |
| IUPAC Name | [4-[[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate |
| SMILES | COc1cc(C=C2N=C(c3ccco3)OC2=O)cc(I)c1OC(C)=O |
| InChI | InChI=1S/C17H12INO6/c1-9(20)24-15-11(18)6-10(8-14(15)22-2)7-12-17(21)25-16(19-12)13-4-3-5-23-13/h3-8H,1-2H3 |
| InChIKey | FYNBWEVBJLIRNA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|