C19H12ClIN2O7 — CID 3119127
[4-[[2-(2-chloro-5-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate (PubChem CID 3119127) has the molecular formula C19H12ClIN2O7 and a molecular weight of 542.67 g/mol. Its IUPAC name is [4-[[2-(2-chloro-5-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate.
| Compound Name | [4-[[2-(2-chloro-5-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 3119127 |
| Molecular Formula | C19H12ClIN2O7 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 541.94 |
| IUPAC Name | [4-[[2-(2-chloro-5-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate |
| SMILES | COc1cc(C=C2N=C(c3cc([N+](=O)[O-])ccc3Cl)OC2=O)cc(I)c1OC(C)=O |
| InChI | InChI=1S/C19H12ClIN2O7/c1-9(24)29-17-14(21)5-10(7-16(17)28-2)6-15-19(25)30-18(22-15)12-8-11(23(26)27)3-4-13(12)20/h3-8H,1-2H3 |
| InChIKey | HBCGJXDJYYHHOZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|