C18H15NO6 — CID 4913334
[2-ethoxy-4-[[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate (PubChem CID 4913334) has the molecular formula C18H15NO6 and a molecular weight of 341.32 g/mol. Its IUPAC name is [2-ethoxy-4-[[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate.
| Compound Name | [2-ethoxy-4-[[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 4913334 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [2-ethoxy-4-[[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
| SMILES | CCOc1cc(C=C2N=C(c3ccco3)OC2=O)ccc1OC(C)=O |
| InChI | InChI=1S/C18H15NO6/c1-3-22-16-10-12(6-7-14(16)24-11(2)20)9-13-18(21)25-17(19-13)15-5-4-8-23-15/h4-10H,3H2,1-2H3 |
| InChIKey | VHSFQDVXHIIBMN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|