C23H16ClNO6 — CID 19663475
[2-chloro-6-ethoxy-4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate (PubChem CID 19663475) has the molecular formula C23H16ClNO6 and a molecular weight of 437.84 g/mol. Its IUPAC name is [2-chloro-6-ethoxy-4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate.
| Compound Name | [2-chloro-6-ethoxy-4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 19663475 |
| Molecular Formula | C23H16ClNO6 |
| Molecular Weight | 437.84 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | [2-chloro-6-ethoxy-4-[(Z)-[2-(furan-2-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccco3)OC2=O)cc(Cl)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H16ClNO6/c1-2-28-19-13-14(12-17-23(27)31-21(25-17)18-9-6-10-29-18)11-16(24)20(19)30-22(26)15-7-4-3-5-8-15/h3-13H,2H2,1H3/b17-12- |
| InChIKey | NRTMEWAXPWHZTQ-ATVHPVEESA-N |
| XLogP | 4.90 |
| TPSA | 87.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.84 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|