C14H7ClINO3 — CID 1126451
(4E)-2-(2-chloro-5-iodophenyl)-4-(furan-2-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 1126451) has the molecular formula C14H7ClINO3 and a molecular weight of 399.57 g/mol. Its IUPAC name is (4E)-2-(2-chloro-5-iodophenyl)-4-(furan-2-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(2-chloro-5-iodophenyl)-4-(furan-2-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 1126451 |
| Molecular Formula | C14H7ClINO3 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 398.92 |
| IUPAC Name | (4E)-2-(2-chloro-5-iodophenyl)-4-(furan-2-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cc(I)ccc2Cl)=N/C1=C/c1ccco1 |
| InChI | InChI=1S/C14H7ClINO3/c15-11-4-3-8(16)6-10(11)13-17-12(14(18)20-13)7-9-2-1-5-19-9/h1-7H/b12-7+ |
| InChIKey | NWBZHAWDUPMYQP-KPKJPENVSA-N |
| XLogP | 3.88 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|