C18H11ClINO4 — CID 1041307
methyl 4-[(Z)-[2-(2-chloro-5-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate (PubChem CID 1041307) has the molecular formula C18H11ClINO4 and a molecular weight of 467.65 g/mol. Its IUPAC name is methyl 4-[(Z)-[2-(2-chloro-5-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[2-(2-chloro-5-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 1041307 |
| Molecular Formula | C18H11ClINO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 466.94 |
| IUPAC Name | methyl 4-[(Z)-[2-(2-chloro-5-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2\N=C(c3cc(I)ccc3Cl)OC2=O)cc1 |
| InChI | InChI=1S/C18H11ClINO4/c1-24-17(22)11-4-2-10(3-5-11)8-15-18(23)25-16(21-15)13-9-12(20)6-7-14(13)19/h2-9H,1H3/b15-8- |
| InChIKey | CGNWFIWNVKFYJJ-NVNXTCNLSA-N |
| XLogP | 4.08 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|