C23H11Cl2I2NO4 — CID 21216694
[4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] 4-chlorobenzoate (PubChem CID 21216694) has the molecular formula C23H11Cl2I2NO4 and a molecular weight of 690.06 g/mol. Its IUPAC name is [4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] 4-chlorobenzoate.
| Compound Name | [4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 21216694 |
| Molecular Formula | C23H11Cl2I2NO4 |
| Molecular Weight | 690.06 g/mol |
| Exact Mass | 688.82 |
| IUPAC Name | [4-[(Z)-[2-(2-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-diiodophenyl] 4-chlorobenzoate |
| SMILES | O=C1OC(c2ccccc2Cl)=N/C1=C\c1cc(I)c(OC(=O)c2ccc(Cl)cc2)c(I)c1 |
| InChI | InChI=1S/C23H11Cl2I2NO4/c24-14-7-5-13(6-8-14)22(29)31-20-17(26)9-12(10-18(20)27)11-19-23(30)32-21(28-19)15-3-1-2-4-16(15)25/h1-11H/b19-11- |
| InChIKey | CFVZSNZGBKDFFX-ODLFYWEKSA-N |
| XLogP | 6.77 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.06 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|