C21H10ClF3INO3 — CID 3357528
2-(2-chloro-5-iodophenyl)-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-oxazol-5-one (PubChem CID 3357528) has the molecular formula C21H10ClF3INO3 and a molecular weight of 543.67 g/mol. Its IUPAC name is 2-(2-chloro-5-iodophenyl)-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(2-chloro-5-iodophenyl)-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3357528 |
| Molecular Formula | C21H10ClF3INO3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 542.93 |
| IUPAC Name | 2-(2-chloro-5-iodophenyl)-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cc(I)ccc2Cl)=NC1=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C21H10ClF3INO3/c22-16-6-4-13(26)9-15(16)19-27-17(20(28)30-19)10-14-5-7-18(29-14)11-2-1-3-12(8-11)21(23,24)25/h1-10H |
| InChIKey | KEDPPFIRQZAWBJ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|