C20H10Cl2INO3 — CID 19670849
(4Z)-4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(4-iodophenyl)-1,3-oxazol-5-one (PubChem CID 19670849) has the molecular formula C20H10Cl2INO3 and a molecular weight of 510.11 g/mol. Its IUPAC name is (4Z)-4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(4-iodophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(4-iodophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19670849 |
| Molecular Formula | C20H10Cl2INO3 |
| Molecular Weight | 510.11 g/mol |
| Exact Mass | 508.91 |
| IUPAC Name | (4Z)-4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-2-(4-iodophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(I)cc2)=N/C1=C\c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C20H10Cl2INO3/c21-12-3-7-16(22)15(9-12)18-8-6-14(26-18)10-17-20(25)27-19(24-17)11-1-4-13(23)5-2-11/h1-10H/b17-10- |
| InChIKey | JKJNSSQMXUVPAP-YVLHZVERSA-N |
| XLogP | 6.20 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.11 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|