C20H10Cl3NO3 — CID 6525805
(4E)-2-(2-chlorophenyl)-4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1,3-oxazol-5-one (PubChem CID 6525805) has the molecular formula C20H10Cl3NO3 and a molecular weight of 418.66 g/mol. Its IUPAC name is (4E)-2-(2-chlorophenyl)-4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(2-chlorophenyl)-4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6525805 |
| Molecular Formula | C20H10Cl3NO3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | (4E)-2-(2-chlorophenyl)-4-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2Cl)=N/C1=C/c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C20H10Cl3NO3/c21-11-5-7-16(23)14(9-11)18-8-6-12(26-18)10-17-20(25)27-19(24-17)13-3-1-2-4-15(13)22/h1-10H/b17-10+ |
| InChIKey | XYRCLDPDROIPFT-LICLKQGHSA-N |
| XLogP | 6.25 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|