C18H9Cl2NO3S — CID 6104686
(4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 6104686) has the molecular formula C18H9Cl2NO3S and a molecular weight of 390.25 g/mol. Its IUPAC name is (4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6104686 |
| Molecular Formula | C18H9Cl2NO3S |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | (4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccs2)=N/C1=C\c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C18H9Cl2NO3S/c19-10-3-5-12(13(20)8-10)15-6-4-11(23-15)9-14-18(22)24-17(21-14)16-2-1-7-25-16/h1-9H/b14-9- |
| InChIKey | OKGBQZWYDBDMIO-ZROIWOOFSA-N |
| XLogP | 5.66 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|