C19H12ClNO3S — CID 1297116
(4Z)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 1297116) has the molecular formula C19H12ClNO3S and a molecular weight of 369.83 g/mol. Its IUPAC name is (4Z)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 1297116 |
| Molecular Formula | C19H12ClNO3S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | (4Z)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | Cc1ccc(-c2ccc(/C=C3\N=C(c4cccs4)OC3=O)o2)cc1Cl |
| InChI | InChI=1S/C19H12ClNO3S/c1-11-4-5-12(9-14(11)20)16-7-6-13(23-16)10-15-19(22)24-18(21-15)17-3-2-8-25-17/h2-10H,1H3/b15-10- |
| InChIKey | KJQSNFGAPJILNZ-GDNBJRDFSA-N |
| XLogP | 5.31 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|