C18H10N2O5S — CID 9313022
(4Z)-4-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 9313022) has the molecular formula C18H10N2O5S and a molecular weight of 366.35 g/mol. Its IUPAC name is (4Z)-4-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9313022 |
| Molecular Formula | C18H10N2O5S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (4Z)-4-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccs2)=N/C1=C\c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C18H10N2O5S/c21-18-14(19-17(25-18)16-2-1-9-26-16)10-13-7-8-15(24-13)11-3-5-12(6-4-11)20(22)23/h1-10H/b14-10- |
| InChIKey | JFVLDHQWQJWSAV-UVTDQMKNSA-N |
| XLogP | 4.26 |
| TPSA | 94.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|