C18H10BrNO3S — CID 7963728
(4Z)-4-[[5-(2-bromophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 7963728) has the molecular formula C18H10BrNO3S and a molecular weight of 400.25 g/mol. Its IUPAC name is (4Z)-4-[[5-(2-bromophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[5-(2-bromophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 7963728 |
| Molecular Formula | C18H10BrNO3S |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | (4Z)-4-[[5-(2-bromophenyl)furan-2-yl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccs2)=N/C1=C\c1ccc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C18H10BrNO3S/c19-13-5-2-1-4-12(13)15-8-7-11(22-15)10-14-18(21)23-17(20-14)16-6-3-9-24-16/h1-10H/b14-10- |
| InChIKey | CXMHGDOARPRURU-UVTDQMKNSA-N |
| XLogP | 5.12 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|