C21H12Cl2N2O5 — CID 3628466
4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2-(4-methyl-3-nitrophenyl)-1,3-oxazol-5-one (PubChem CID 3628466) has the molecular formula C21H12Cl2N2O5 and a molecular weight of 443.24 g/mol. Its IUPAC name is 4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2-(4-methyl-3-nitrophenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2-(4-methyl-3-nitrophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3628466 |
| Molecular Formula | C21H12Cl2N2O5 |
| Molecular Weight | 443.24 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2-(4-methyl-3-nitrophenyl)-1,3-oxazol-5-one |
| SMILES | Cc1ccc(C2=NC(=Cc3ccc(-c4ccc(Cl)cc4Cl)o3)C(=O)O2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H12Cl2N2O5/c1-11-2-3-12(8-18(11)25(27)28)20-24-17(21(26)30-20)10-14-5-7-19(29-14)15-6-4-13(22)9-16(15)23/h2-10H,1H3 |
| InChIKey | PSWRTZUIWRRRIV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 94.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.24 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|