About 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one
4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one (PubChem CID 3926020) has the molecular formula C20H10Cl3NO3
and a molecular weight of 418.66 g/mol. Its IUPAC name is 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
| PubChem CID | 3926020 |
| Molecular Formula | C20H10Cl3NO3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(Cl)cc2Cl)=NC1=Cc1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C20H10Cl3NO3/c21-12-3-1-2-11(8-12)18-7-5-14(26-18)10-17-20(25)27-19(24-17)15-6-4-13(22)9-16(15)23/h1-10H |
| InChIKey | QUDADVMJYBOWST-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one?
The IUPAC name of 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one (CID 3926020) is 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one.
What is the SMILES notation for 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one?
The canonical SMILES for 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one is O=C1OC(c2ccc(Cl)cc2Cl)=NC1=Cc1ccc(-c2cccc(Cl)c2)o1.
What is the InChIKey of 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one?
The InChIKey is QUDADVMJYBOWST-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10Cl3NO3/c21-12-3-1-2-11(8-12)18-7-5-14(26-18)10-17-20(25)27-19(24-17)15-6-4-13(22)9-16(15)23/h1-10H.
What are the key properties of 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one?
4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one has a molecular weight of 418.66 g/mol, XLogP of 6.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one is sourced from PubChem (CID 3926020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).