C20H9Cl2IN2O5 — CID 19673596
(4Z)-2-(2-chloro-5-iodophenyl)-4-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-1,3-oxazol-5-one (PubChem CID 19673596) has the molecular formula C20H9Cl2IN2O5 and a molecular weight of 555.11 g/mol. Its IUPAC name is (4Z)-2-(2-chloro-5-iodophenyl)-4-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2-chloro-5-iodophenyl)-4-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19673596 |
| Molecular Formula | C20H9Cl2IN2O5 |
| Molecular Weight | 555.11 g/mol |
| Exact Mass | 553.89 |
| IUPAC Name | (4Z)-2-(2-chloro-5-iodophenyl)-4-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cc(I)ccc2Cl)=N/C1=C\c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C20H9Cl2IN2O5/c21-15-5-1-10(23)7-14(15)19-24-17(20(26)30-19)9-12-3-6-18(29-12)13-4-2-11(25(27)28)8-16(13)22/h1-9H/b17-9- |
| InChIKey | JQTRRQCVFCTFAZ-MFOYZWKCSA-N |
| XLogP | 6.11 |
| TPSA | 94.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.11 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|