C13H8N2O3 — CID 108935786
(4E)-4-(furan-2-ylmethylidene)-2-pyridin-4-yl-1,3-oxazol-5-one (PubChem CID 108935786) has the molecular formula C13H8N2O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is (4E)-4-(furan-2-ylmethylidene)-2-pyridin-4-yl-1,3-oxazol-5-one.
| Compound Name | (4E)-4-(furan-2-ylmethylidene)-2-pyridin-4-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108935786 |
| Molecular Formula | C13H8N2O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | (4E)-4-(furan-2-ylmethylidene)-2-pyridin-4-yl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccncc2)=N/C1=C/c1ccco1 |
| InChI | InChI=1S/C13H8N2O3/c16-13-11(8-10-2-1-7-17-10)15-12(18-13)9-3-5-14-6-4-9/h1-8H/b11-8+ |
| InChIKey | ZXEADBAYFVWMJO-DHZHZOJOSA-N |
| XLogP | 2.02 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|