C18H16N2O5 — CID 108936738
(4E)-2-pyridin-4-yl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 108936738) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is (4E)-2-pyridin-4-yl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-pyridin-4-yl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108936738 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (4E)-2-pyridin-4-yl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2/N=C(c3ccncc3)OC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H16N2O5/c1-22-14-9-11(10-15(23-2)16(14)24-3)8-13-18(21)25-17(20-13)12-4-6-19-7-5-12/h4-10H,1-3H3/b13-8+ |
| InChIKey | GUDLBQGAMOASHL-MDWZMJQESA-N |
| XLogP | 2.45 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|