C19H16INO5 — CID 22302549
(4Z)-2-(2-iodophenyl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 22302549) has the molecular formula C19H16INO5 and a molecular weight of 465.24 g/mol. Its IUPAC name is (4Z)-2-(2-iodophenyl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2-iodophenyl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 22302549 |
| Molecular Formula | C19H16INO5 |
| Molecular Weight | 465.24 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | (4Z)-2-(2-iodophenyl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccccc3I)OC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C19H16INO5/c1-23-15-9-11(10-16(24-2)17(15)25-3)8-14-19(22)26-18(21-14)12-6-4-5-7-13(12)20/h4-10H,1-3H3/b14-8- |
| InChIKey | XCJJCOLBIYCMFS-ZSOIEALJSA-N |
| XLogP | 3.66 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|