C16H10N2O4 — CID 18527679
(4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-pyridin-4-yl-1,3-oxazol-5-one (PubChem CID 18527679) has the molecular formula C16H10N2O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is (4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-pyridin-4-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-pyridin-4-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 18527679 |
| Molecular Formula | C16H10N2O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-pyridin-4-yl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccncc2)=N/C1=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H10N2O4/c19-16-12(18-15(22-16)11-3-5-17-6-4-11)7-10-1-2-13-14(8-10)21-9-20-13/h1-8H,9H2/b12-7- |
| InChIKey | JRDFTJHMIDZPJO-GHXNOFRVSA-N |
| XLogP | 2.15 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|