C16H11N3O3 — CID 136894404
(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-2-pyridin-4-yl-1H-imidazol-5-one (PubChem CID 136894404) has the molecular formula C16H11N3O3 and a molecular weight of 293.28 g/mol. Its IUPAC name is (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-2-pyridin-4-yl-1H-imidazol-5-one.
| Compound Name | (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-2-pyridin-4-yl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894404 |
| Molecular Formula | C16H11N3O3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (4E)-4-(1,3-benzodioxol-5-ylmethylidene)-2-pyridin-4-yl-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccncc2)=N/C1=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H11N3O3/c20-16-12(18-15(19-16)11-3-5-17-6-4-11)7-10-1-2-13-14(8-10)22-9-21-13/h1-8H,9H2,(H,18,19,20)/b12-7+ |
| InChIKey | FIKQWJYNXQICLM-KPKJPENVSA-N |
| XLogP | 1.73 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|