C18H13ClN2O3 — CID 136894359
(4E)-2-(2-chlorophenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1H-imidazol-5-one (PubChem CID 136894359) has the molecular formula C18H13ClN2O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is (4E)-2-(2-chlorophenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1H-imidazol-5-one.
| Compound Name | (4E)-2-(2-chlorophenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894359 |
| Molecular Formula | C18H13ClN2O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (4E)-2-(2-chlorophenyl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccccc2Cl)=N/C1=C/c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H13ClN2O3/c19-13-4-2-1-3-12(13)17-20-14(18(22)21-17)9-11-5-6-15-16(10-11)24-8-7-23-15/h1-6,9-10H,7-8H2,(H,20,21,22)/b14-9+ |
| InChIKey | MYZXETBGUBZPMH-NTEUORMPSA-N |
| XLogP | 3.03 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|