C17H11ClN2O3 — CID 135519720
4-(1,3-benzodioxol-5-ylmethylidene)-2-(2-chlorophenyl)-1H-imidazol-5-one (PubChem CID 135519720) has the molecular formula C17H11ClN2O3 and a molecular weight of 326.74 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylidene)-2-(2-chlorophenyl)-1H-imidazol-5-one.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethylidene)-2-(2-chlorophenyl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135519720 |
| Molecular Formula | C17H11ClN2O3 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethylidene)-2-(2-chlorophenyl)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2ccccc2Cl)=NC1=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H11ClN2O3/c18-12-4-2-1-3-11(12)16-19-13(17(21)20-16)7-10-5-6-14-15(8-10)23-9-22-14/h1-8H,9H2,(H,19,20,21) |
| InChIKey | CBYSJXPJXGOYQK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|